Other Solvents
Filtered Search Results
Methyl sulfoxide-d6, for NMR, 99.5+ atom % D
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 MDL Number: MFCD00002090 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide PubChem CID: 75151 SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| PubChem CID | 75151 |
|---|---|
| CAS | 2206-27-1 |
| Molecular Weight (g/mol) | 84.17 |
| MDL Number | MFCD00002090 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | dimethyl sulfoxide-d6,dmso-d6,dimethylsulfoxide-d6,deuterated dmso,methane-d3,sulfinylbis-9ci,methane-d3, sulfinylbis,hexadeuterodimethyl sulfoxide,methane-d3-, sulfinylbis,methanesulfinylmethyl hydrogen,dimethyl-d6 sulfoxide |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |
Diethyl ether, 99+%, pure, stabilized with BHT
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Diethyl ether, 99.5%, Extra Dry, stabilized, AcroSeal™
CAS: 60-29-7 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00011646 InChI Key: RTZKZFJDLAIYFH-UHFFFAOYSA-N Synonym: diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether PubChem CID: 3283 ChEBI: CHEBI:35702 IUPAC Name: ethoxyethane SMILES: CCOCC
| PubChem CID | 3283 |
|---|---|
| CAS | 60-29-7 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35702 |
| MDL Number | MFCD00011646 |
| SMILES | CCOCC |
| Synonym | diethyl ether,ether,ethyl ether,diethyl oxide,ethyl oxide,aether,pronarcol,anesthetic ether,3-oxapentane,anaesthetic ether |
| IUPAC Name | ethoxyethane |
| InChI Key | RTZKZFJDLAIYFH-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
tert-Butanol, 99.5%, extra pure
CAS: 75-65-0 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.123 MDL Number: MFCD00004464 InChI Key: DKGAVHZHDRPRBM-UHFFFAOYSA-N Synonym: tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol PubChem CID: 6386 ChEBI: CHEBI:45895 IUPAC Name: 2-methylpropan-2-ol SMILES: CC(C)(C)O
| PubChem CID | 6386 |
|---|---|
| CAS | 75-65-0 |
| Molecular Weight (g/mol) | 74.123 |
| ChEBI | CHEBI:45895 |
| MDL Number | MFCD00004464 |
| SMILES | CC(C)(C)O |
| Synonym | tert-butanol,tert-butyl alcohol,2-methyl-2-propanol,t-butanol,t-butyl hydroxide,1,1-dimethylethanol,trimethylcarbinol,trimethyl methanol,2-propanol, 2-methyl,t-butyl alcohol |
| IUPAC Name | 2-methylpropan-2-ol |
| InChI Key | DKGAVHZHDRPRBM-UHFFFAOYSA-N |
| Molecular Formula | C4H10O |
Cyclohexanone, ACS, 99+%
CAS: 108-94-1 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.145 MDL Number: MFCD00001625 InChI Key: JHIVVAPYMSGYDF-UHFFFAOYSA-N Synonym: ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon PubChem CID: 7967 ChEBI: CHEBI:17854 IUPAC Name: cyclohexanone SMILES: C1CCC(=O)CC1
| PubChem CID | 7967 |
|---|---|
| CAS | 108-94-1 |
| Molecular Weight (g/mol) | 98.145 |
| ChEBI | CHEBI:17854 |
| MDL Number | MFCD00001625 |
| SMILES | C1CCC(=O)CC1 |
| Synonym | ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon |
| IUPAC Name | cyclohexanone |
| InChI Key | JHIVVAPYMSGYDF-UHFFFAOYSA-N |
| Molecular Formula | C6H10O |
Pyridine, 99.5%, Extra Dry, AcroSeal™
CAS: 110-86-1 Molecular Formula: C5H5N Molecular Weight (g/mol): 79.102 MDL Number: MFCD00011732 InChI Key: JUJWROOIHBZHMG-UHFFFAOYSA-N Synonym: azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 PubChem CID: 1049 ChEBI: CHEBI:16227 IUPAC Name: pyridine SMILES: C1=CC=NC=C1
| PubChem CID | 1049 |
|---|---|
| CAS | 110-86-1 |
| Molecular Weight (g/mol) | 79.102 |
| ChEBI | CHEBI:16227 |
| MDL Number | MFCD00011732 |
| SMILES | C1=CC=NC=C1 |
| Synonym | azabenzene,azine,pyridin,piridina,pirydyna,pyridin german,pirydyna polish,piridina italian,rcra waste number u196,caswell no. 717 |
| IUPAC Name | pyridine |
| InChI Key | JUJWROOIHBZHMG-UHFFFAOYSA-N |
| Molecular Formula | C5H5N |
sec-Butanol, 99%, Extra Pure
CAS: 78-92-2 Molecular Formula: C4H10O Molecular Weight (g/mol): 74.12 MDL Number: MFCD00004569 InChI Key: BTANRVKWQNVYAZ-UHFFFAOYNA-N Synonym: 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol PubChem CID: 6568 ChEBI: CHEBI:35687 IUPAC Name: butan-2-ol SMILES: CCC(C)O
| PubChem CID | 6568 |
|---|---|
| CAS | 78-92-2 |
| Molecular Weight (g/mol) | 74.12 |
| ChEBI | CHEBI:35687 |
| MDL Number | MFCD00004569 |
| SMILES | CCC(C)O |
| Synonym | 2-butanol,sec-butanol,sec-butyl alcohol,2-hydroxybutane,2-butyl alcohol,s-butyl alcohol,butylene hydrate,s-butanol,1-methyl-1-propanol,1-methylpropyl alcohol |
| IUPAC Name | butan-2-ol |
| InChI Key | BTANRVKWQNVYAZ-UHFFFAOYNA-N |
| Molecular Formula | C4H10O |
Toluene-d8, for NMR, 99+ atom % D
CAS: 2037-26-5 Molecular Formula: C7H8 Molecular Weight (g/mol): 100.19 MDL Number: MFCD00044638 InChI Key: YXFVVABEGXRONW-JGUCLWPXSA-N Synonym: toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d PubChem CID: 74861 IUPAC Name: 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene SMILES: CC1=CC=CC=C1
| PubChem CID | 74861 |
|---|---|
| CAS | 2037-26-5 |
| Molecular Weight (g/mol) | 100.19 |
| MDL Number | MFCD00044638 |
| SMILES | CC1=CC=CC=C1 |
| Synonym | toluene-d8,2h8 toluene,perdeuteriotoluene,benzene-d5, methyl-d3,perdeuterotoluene,benzene-d5-, methyl-d3,1,2,3,4,5-pentadeuterio-6-trideuteriomethyl benzene,toluene d8,toluene-d8, 99 atom % d,toluene-d8, 99.6 atom % d |
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-(trideuteriomethyl)benzene |
| InChI Key | YXFVVABEGXRONW-JGUCLWPXSA-N |
| Molecular Formula | C7H8 |
Xylenes, ACS, 98.5+% (Assay, isomers plus ethylbenzene)
CAS: 1330-20-7 Molecular Formula: (CH3)2C6H4 MDL Number: MFCD00077264
| CAS | 1330-20-7 |
|---|---|
| MDL Number | MFCD00077264 |
| Molecular Formula | (CH3)2C6H4 |
Cyclohexanone, 99+%, ACS reagent
CAS: 108-94-1 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.145 InChI Key: JHIVVAPYMSGYDF-UHFFFAOYSA-N Synonym: ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon PubChem CID: 7967 ChEBI: CHEBI:17854 IUPAC Name: cyclohexanone SMILES: C1CCC(=O)CC1
| PubChem CID | 7967 |
|---|---|
| CAS | 108-94-1 |
| Molecular Weight (g/mol) | 98.145 |
| ChEBI | CHEBI:17854 |
| SMILES | C1CCC(=O)CC1 |
| Synonym | ketohexamethylene,pimelic ketone,sextone,cyclohexyl ketone,nadone,anone,anon,cyclohexanon,hytrol o,hexanon |
| IUPAC Name | cyclohexanone |
| InChI Key | JHIVVAPYMSGYDF-UHFFFAOYSA-N |
| Molecular Formula | C6H10O |
| Water | 0.1% max. (K.F.) |
|---|---|
| Viscosity | 1.1 mPa.s (20°C) |
| Linear Formula | CH3OCH2CH2OCH3 |
| Density | 0.8670g/mL |
| Name Note | Stabilized with BHT |
| Percent Purity | ≥99% |
| Fieser | 01,267; 02,143; 16,229 |
| Infrared Spectrum | Authentic |
| pH | 6 to 7.5 (1:9) |
| Formula Weight | 90.12 |
| Melting Point | -69.0°C |
| Boiling Point | 84.0°C to 86.0°C |
| Physical Form | Liquid |
| Chemical Name or Material | Ethylene glycol dimethyl ether |
| Grade | Extra Pure |
| Merck Index | 15, 3245 |
| Assay Percent Range | 99+% |
| CAS | 128-37-0 |
| Health Hazard 3 | GHS P Statement: Obtain special instructions before use. IF exposed or concerned: Get medical advice/attention. Keep container tightly closed. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing. Keep away from heat/sparks/open flames/hot surfaces. - No smoking. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Health Hazard 2 | GHS H Statement: Harmful if inhaled. May damage fertility. May damage the unborn child. Highly flammable liquid and vapor. May form explosive peroxides. |
| Flash Point | −6°C |
| Health Hazard 1 | Danger |
| Refractive Index | 1.3785 to 1.3805 |
| Synonym | monoglyme,ethylene glycol dimethyl ether,glyme,dimethyl cellosolve,egdme,ethane, 1,2-dimethoxy,dimethoxyethane,2,5-dioxahexane,glycol dimethyl ether,ethylene dimethyl ether |
| Beilstein | 01, 467 |
| Specific Gravity | 0.867 |
1-Methyl-2-pyrrolidinone, 99.5%, for HPLC
CAS: 872-50-4 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.133 MDL Number: MFCD00003193 InChI Key: SECXISVLQFMRJM-UHFFFAOYSA-N Synonym: 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl PubChem CID: 13387 ChEBI: CHEBI:7307 IUPAC Name: 1-methylpyrrolidin-2-one SMILES: CN1CCCC1=O
| PubChem CID | 13387 |
|---|---|
| CAS | 872-50-4 |
| Molecular Weight (g/mol) | 99.133 |
| ChEBI | CHEBI:7307 |
| MDL Number | MFCD00003193 |
| SMILES | CN1CCCC1=O |
| Synonym | 1-methyl-2-pyrrolidinone,n-methyl-2-pyrrolidone,n-methylpyrrolidone,1-methyl-2-pyrrolidone,methylpyrrolidone,m-pyrol,n-methyl-2-pyrrolidinone,n-methylpyrrolidinone,1-methylpyrrolidinone,2-pyrrolidinone, 1-methyl |
| IUPAC Name | 1-methylpyrrolidin-2-one |
| InChI Key | SECXISVLQFMRJM-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Carbon disulfide, HPLC Grade, 99.8+%
CAS: 75-15-0 Molecular Formula: CS2 Molecular Weight (g/mol): 76.131 MDL Number: MFCD00011321 InChI Key: QGJOPFRUJISHPQ-UHFFFAOYSA-N Synonym: carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide PubChem CID: 6348 ChEBI: CHEBI:23012 IUPAC Name: methanedithione SMILES: C(=S)=S
| PubChem CID | 6348 |
|---|---|
| CAS | 75-15-0 |
| Molecular Weight (g/mol) | 76.131 |
| ChEBI | CHEBI:23012 |
| MDL Number | MFCD00011321 |
| SMILES | C(=S)=S |
| Synonym | carbon disulfide,carbon disulphide,carbon bisulfide,dithiocarbonic anhydride,carbon bisulphide,schwefelkohlenstoff,weeviltox,wegla dwusiarczek,solfuro di carbonio,carbondisulphide |
| IUPAC Name | methanedithione |
| InChI Key | QGJOPFRUJISHPQ-UHFFFAOYSA-N |
| Molecular Formula | CS2 |
N,N-Dimethylacetamide, HPLC Grade, 99.5+%
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Dimethyl sulfoxide-D6 deuteration degree min 99.8% for NMR spectroscopy MagniSolv™, MilliporeSigma™
CAS: 2206-27-1 Molecular Formula: C2H6OS Molecular Weight (g/mol): 84.17 InChI Key: IAZDPXIOMUYVGZ-WFGJKAKNSA-N Synonym: Hexadeuterodimethyl sulfoxide,DMSO deuterated IUPAC Name: (²H₃)methanesulfinyl(²H₃)methane SMILES: [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H]
| CAS | 2206-27-1 |
|---|---|
| Molecular Weight (g/mol) | 84.17 |
| SMILES | [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| Synonym | Hexadeuterodimethyl sulfoxide,DMSO deuterated |
| IUPAC Name | (²H₃)methanesulfinyl(²H₃)methane |
| InChI Key | IAZDPXIOMUYVGZ-WFGJKAKNSA-N |
| Molecular Formula | C2H6OS |